Products 7253-22-7

CAS 7253-22-7 is the registry number for 4,6-Dichloroquinazoline, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100g.

Structural formula: {0} (CAS {1})

4,6-dichloroquinazoline (CAS 7253-22-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,6-dichloroquinazoline. InChIKey: JEBCOVKUVLFOGR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2N2
Molecular weight199.03 g/mol
IUPAC name4,6-dichloroquinazoline
InChIKeyJEBCOVKUVLFOGR-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)C(=NC=N2)Cl

Computed by PubChem (NCBI)