CAS 7253-22-7 is the registry number for 4,6-Dichloroquinazoline, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100g.
4,6-dichloroquinazoline (CAS 7253-22-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,6-dichloroquinazoline. InChIKey: JEBCOVKUVLFOGR-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,6-dichloroquinazoline |
| InChIKey | JEBCOVKUVLFOGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NC=N2)Cl |
Computed by PubChem (NCBI)