CAS 67092-19-7 is the registry number for 2,7-Dichloroquinazoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,7-dichloroquinazoline (CAS 67092-19-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,7-dichloroquinazoline. InChIKey: CBPZMPNJBUJQQY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,7-dichloroquinazoline |
| InChIKey | CBPZMPNJBUJQQY-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(N=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)