CAS 7148-34-7 appears in our catalog under these names: 4,8-Dichloroquinazoline, 98%, 4,8–Dichloro–quinazoline, 4,8-Dichloroquinazoline, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g.
4,8-dichloroquinazoline (CAS 7148-34-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,8-dichloroquinazoline. InChIKey: LGRUYTZVYJCUTH-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,8-dichloroquinazoline |
| InChIKey | LGRUYTZVYJCUTH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=CN=C2Cl |
Computed by PubChem (NCBI)