cas: 39489-77-5 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-nitrophenol, 98% (CAS 39489-77-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210655-5G |
| cas | 39489-77-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,4-dichloro-5-nitrophenol (CAS 39489-77-5) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,4-dichloro-5-nitrophenol. InChIKey: OFAPWTOOMSVMIU-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,4-dichloro-5-nitrophenol |
| InChIKey | OFAPWTOOMSVMIU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)