2,4-Dichloro-6-fluorobenzoic acid, 98%
cas: 904285-09-2 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-fluorobenzoic acid, 98% (CAS 904285-09-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTGA-250mg |
| cas | 904285-09-2 |
| size | 250mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 568.40 Pln | |
| Chemat | 10g | 1058.00 Pln | |
| Chemat | 25g | 2080.40 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 700.81 Pln | |
| Fluorochem | 10g | 1169.40 Pln | |
| Fluorochem | 25g | 2804.24 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-6-fluorobenzoic acid (CAS 904285-09-2) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,4-dichloro-6-fluorobenzoic acid. InChIKey: RGGDLWPZNITCMJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 2,4-dichloro-6-fluorobenzoic acid |
| InChIKey | RGGDLWPZNITCMJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)