2,4-Dichloro-6-methylbenzene-1-sulfonyl chloride, 95%
cas: 175278-26-9 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-methylbenzene-1-sulfonyl chloride, 95% (CAS 175278-26-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A152100-100mg |
| cas | 175278-26-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 426.00 Pln | |
| Ambeed | 5g | 1544.06 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 453.20 Pln | |
| BLDpharm | 5g | 1663.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,4-dichloro-6-methylbenzenesulfonyl chloride (CAS 175278-26-9) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: 2,4-dichloro-6-methylbenzenesulfonyl chloride. InChIKey: LHMUXGRPLOUXAY-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 2,4-dichloro-6-methylbenzenesulfonyl chloride |
| InChIKey | LHMUXGRPLOUXAY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,4-dichloro-6-methylbenzenesulfonyl chloride, 2,4-dichloro-6-methylbenzenesulphonyl chloride, 2,4-Dichloro-6-methylbenzene-1-sulfonyl chloride, 2,4-dichloro-6-methyl-benzenesulfonyl Chloride, Benzenesulfonyl chloride, 2,4-dichloro-6-methyl-, 2,4-Dichloro-6-methyl-Benzenesulfonylchloride, LHMUXGRPLOUX, Benzenesulfonylchloride, 2,4-dichloro-6-methyl-, LHMUXGRPLOUXAY-UHFFFAOYSA-N, (2,4-dichloro-6-methylphenyl)chlorosulfone