Products 175278-26-9

CAS 175278-26-9 appears in our catalog under these names: 2,4-Dichloro-6-methylbenzenesulphonyl chloride, 95%, 2,4-Dichloro-6-methyl-Benzenesulfonylchloride, 2,4-Dichloro-6-methylbenzene-1-sulfonyl chloride 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 1000mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-6-methylbenzenesulfonyl chloride (CAS 175278-26-9) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: 2,4-dichloro-6-methylbenzenesulfonyl chloride. InChIKey: LHMUXGRPLOUXAY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3O2S
Molecular weight259.5 g/mol
IUPAC name2,4-dichloro-6-methylbenzenesulfonyl chloride
InChIKeyLHMUXGRPLOUXAY-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1S(=O)(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)