CAS 175278-26-9 appears in our catalog under these names: 2,4-Dichloro-6-methylbenzenesulphonyl chloride, 95%, 2,4-Dichloro-6-methyl-Benzenesulfonylchloride, 2,4-Dichloro-6-methylbenzene-1-sulfonyl chloride 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 1000mg, 100mg, 250mg.
2,4-dichloro-6-methylbenzenesulfonyl chloride (CAS 175278-26-9) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: 2,4-dichloro-6-methylbenzenesulfonyl chloride. InChIKey: LHMUXGRPLOUXAY-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 2,4-dichloro-6-methylbenzenesulfonyl chloride |
| InChIKey | LHMUXGRPLOUXAY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)