Products 88691-50-3

CAS 88691-50-3 appears in our catalog under these names: (2,4-Dichlorophenyl)-methanesulfonyl chloride, 95%, (2,4-Dichlorophenyl)methanesulfonyl chloride, 97%, (2,4-Dichlorophenyl)methanesulfonyl chloride, 97% , (2,4-Dichlorophenyl)-methanesulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Thermo Scientific, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.

Structural formula: {0} (CAS {1})

(2,4-dichlorophenyl)methanesulfonyl chloride (CAS 88691-50-3) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: (2,4-dichlorophenyl)methanesulfonyl chloride. InChIKey: SNLHLLYEHFIELA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3O2S
Molecular weight259.5 g/mol
IUPAC name(2,4-dichlorophenyl)methanesulfonyl chloride
InChIKeySNLHLLYEHFIELA-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)CS(=O)(=O)Cl

Computed by PubChem (NCBI)