CAS 88691-50-3 appears in our catalog under these names: (2,4-Dichlorophenyl)-methanesulfonyl chloride, 95%, (2,4-Dichlorophenyl)methanesulfonyl chloride, 97%, (2,4-Dichlorophenyl)methanesulfonyl chloride, 97% , (2,4-Dichlorophenyl)-methanesulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Thermo Scientific, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
(2,4-dichlorophenyl)methanesulfonyl chloride (CAS 88691-50-3) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: (2,4-dichlorophenyl)methanesulfonyl chloride. InChIKey: SNLHLLYEHFIELA-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | (2,4-dichlorophenyl)methanesulfonyl chloride |
| InChIKey | SNLHLLYEHFIELA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)