Products 28286-86-4

CAS 28286-86-4 appears in our catalog under these names: 2,4-Dichloro-5-methylbenzenesulfonyl chloride, 95%, 2,4-Dichloro-5-methylbenzene-1-sulfonyl chloride, 95+%, 2,4-Dichloro-5-methylbenzenesulfonyl chloride, 97% , 2,4-dichloro-5-methylbenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 10g, 25g, 5g, 50g, 2.5g, 0,25g, 2,5g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-methylbenzenesulfonyl chloride (CAS 28286-86-4) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: 2,4-dichloro-5-methylbenzenesulfonyl chloride. InChIKey: DFBKCDYLPLBSJP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3O2S
Molecular weight259.5 g/mol
IUPAC name2,4-dichloro-5-methylbenzenesulfonyl chloride
InChIKeyDFBKCDYLPLBSJP-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1Cl)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)