CAS 1215295-88-7 appears in our catalog under these names: 4,5-Dichloro-2-methylbenzenesulfonyl chloride, 95%, 4,5-Dichloro-2-methylbenzenesulfonyl chloride 95%, 4,5-Dichloro-2-methylbenzenesulfonyl Chloride, 95+%, 95+%, 4,5-dichloro-2-methylbenzenesulfonyl chloride, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4,5-dichloro-2-methylbenzenesulfonyl chloride (CAS 1215295-88-7) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: 4,5-dichloro-2-methylbenzenesulfonyl chloride. InChIKey: TYZBDEJHZYVWRM-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 4,5-dichloro-2-methylbenzenesulfonyl chloride |
| InChIKey | TYZBDEJHZYVWRM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)