CAS 163295-70-3 appears in our catalog under these names: (3,5–Dichlorophenyl)methanesulfonyl chloride, 3,5-Dichloro-alpha-toluenesulfonyl chloride, 96% , (3,5-Dichlorophenyl)methanesulfonyl chloride, (3,5-Dichlorophenyl)methanesulfonyl chloride, 97%, (3,5-Dichlorophenyl)methanesulfonyl chloride 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50g, 25g, 5g.
(3,5-dichlorophenyl)methanesulfonyl chloride (CAS 163295-70-3) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: (3,5-dichlorophenyl)methanesulfonyl chloride. InChIKey: GZMJRPMBVICCFL-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | (3,5-dichlorophenyl)methanesulfonyl chloride |
| InChIKey | GZMJRPMBVICCFL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)