Products 85952-31-4

CAS 85952-31-4 appears in our catalog under these names: (2,6-Dichlorophenyl)methanesulfonyl chloride, 95%, (2,6-Dichlorophenyl)methanesulfonyl chloride 95%, (2,6-dichlorophenyl)methanesulfonyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(2,6-dichlorophenyl)methanesulfonyl chloride (CAS 85952-31-4) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: (2,6-dichlorophenyl)methanesulfonyl chloride. InChIKey: JAIDEMJIMSTEKX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3O2S
Molecular weight259.5 g/mol
IUPAC name(2,6-dichlorophenyl)methanesulfonyl chloride
InChIKeyJAIDEMJIMSTEKX-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)CS(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)