CAS 24653-79-0 appears in our catalog under these names: 3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride, 95%, 3,5-Dichloro-4-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3,5-dichloro-4-methylbenzenesulfonyl chloride (CAS 24653-79-0) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: 3,5-dichloro-4-methylbenzenesulfonyl chloride. InChIKey: OLFWFOJPCBLRSU-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 3,5-dichloro-4-methylbenzenesulfonyl chloride |
| InChIKey | OLFWFOJPCBLRSU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)