Products 473477-22-4
CAS 473477-22-4 appears in our catalog under these names: 2,5-Dichloro-4-methylbenzene-1-sulfonyl chloride, 2,5-Dichloro-4-methylbenzene-1-sulfonyl chloride, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
2,5-dichloro-4-methylbenzenesulfonyl chloride (CAS 473477-22-4) is a chemical compound with the molecular formula C7H5Cl3O2S and a molecular weight of 259.5 g/mol. IUPAC name: 2,5-dichloro-4-methylbenzenesulfonyl chloride. InChIKey: PKTRXKJNKSWSTH-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O2S |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 2,5-dichloro-4-methylbenzenesulfonyl chloride |
| InChIKey | PKTRXKJNKSWSTH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)