cas: 1395417-65-8 — see every product listed under this CAS number, including other names
2,4-Difluoro-5-methoxyphenylboronic acid 98% (CAS 1395417-65-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A123127-100mg |
| cas | 1395417-65-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2795.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A123127 |
(2,4-difluoro-5-methoxyphenyl)boronic acid (CAS 1395417-65-8) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,4-difluoro-5-methoxyphenyl)boronic acid. InChIKey: LPDXDGZARPKGCF-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,4-difluoro-5-methoxyphenyl)boronic acid |
| InChIKey | LPDXDGZARPKGCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)OC)(O)O |
Computed by PubChem (NCBI)