cas: 153775-33-8 — see every product listed under this CAS number, including other names
2,4-Difluoro-5-nitrobenzoic acid, 97%, 97% (CAS 153775-33-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FS0-1g |
| cas | 153775-33-8 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 410.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-difluoro-5-nitrobenzoic acid (CAS 153775-33-8) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,4-difluoro-5-nitrobenzoic acid. InChIKey: MDFSGDMPHMKKGB-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,4-difluoro-5-nitrobenzoic acid |
| InChIKey | MDFSGDMPHMKKGB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)F)C(=O)O |
Computed by PubChem (NCBI)