CAS 153775-33-8 appears in our catalog under these names: 2,4–Difluoro–5–nitrobenzoic acid, 2,4-Difluoro-5-nitrobenzoic acid, 97% , 2,4-Difluoro-5-nitrobenzoic acid 97%, 2,4-Difluoro-5-nitrobenzoic acid, 97%, 97%, 2,4-Difluoro-5-nitrobenzoic acid, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
2,4-difluoro-5-nitrobenzoic acid (CAS 153775-33-8) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,4-difluoro-5-nitrobenzoic acid. InChIKey: MDFSGDMPHMKKGB-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,4-difluoro-5-nitrobenzoic acid |
| InChIKey | MDFSGDMPHMKKGB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)F)C(=O)O |
Computed by PubChem (NCBI)