CAS 116465-48-6 appears in our catalog under these names: 2,5–Difluoro–4–nitrobenzoic acid, 2,5-Difluoro-4-nitrobenzoic acid, 97% , 2,5-Difluoro-4-nitrobenzoic acid 95%, 2,5-Difluoro-4-nitrobenzoic Acid, 98%, 98%, 2,5-Difluoro-4-nitrobenzoic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g, 500g, 1000g.
2,5-difluoro-4-nitrobenzoic acid (CAS 116465-48-6) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,5-difluoro-4-nitrobenzoic acid. InChIKey: GPTNSBLYGCZJQV-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,5-difluoro-4-nitrobenzoic acid |
| InChIKey | GPTNSBLYGCZJQV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)