CAS 196194-57-7 appears in our catalog under these names: 2,6-Difluoro-4-nitrobenzoic acid, 95%, 2,6-Difluoro-4-nitrobenzoic acid, 98%, 98%, 2,6-Difluoro-4-nitrobenzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,6-difluoro-4-nitrobenzoic acid (CAS 196194-57-7) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,6-difluoro-4-nitrobenzoic acid. InChIKey: VDDOEPCUFDOETL-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,6-difluoro-4-nitrobenzoic acid |
| InChIKey | VDDOEPCUFDOETL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)