Products 196194-57-7

CAS 196194-57-7 appears in our catalog under these names: 2,6-Difluoro-4-nitrobenzoic acid, 95%, 2,6-Difluoro-4-nitrobenzoic acid, 98%, 98%, 2,6-Difluoro-4-nitrobenzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2,6-difluoro-4-nitrobenzoic acid (CAS 196194-57-7) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,6-difluoro-4-nitrobenzoic acid. InChIKey: VDDOEPCUFDOETL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3F2NO4
Molecular weight203.10 g/mol
IUPAC name2,6-difluoro-4-nitrobenzoic acid
InChIKeyVDDOEPCUFDOETL-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)C(=O)O)F)[N+](=O)[O-]

Computed by PubChem (NCBI)