CAS 1131580-60-3 appears in our catalog under these names: 3,5-Difluoro-4-nitrobenzoic acid, 98%, 3,5-Difluoro-4-nitrobenzoic acid 95%, 3,5-Difluoro-4-nitrobenzoic acid, 95%, 95%, 3,5-Difluoro-4-nitrobenzoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g.
3,5-difluoro-4-nitrobenzoic acid (CAS 1131580-60-3) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 3,5-difluoro-4-nitrobenzoic acid. InChIKey: CUDACLYZECMWDR-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 3,5-difluoro-4-nitrobenzoic acid |
| InChIKey | CUDACLYZECMWDR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)