CAS 83141-10-0 appears in our catalog under these names: 2,6-Difluoro-3-nitrobenzoic Acid, >98.0%(GC)(T), 2,6-Difluoro-3-nitrobenzoic acid 98%, 2,6-Difluoro-3-nitrobenzoic acid, 98%, 98%, 2,6-Difluoro-3-nitrobenzoic acid, 98%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 500g, 1000g.
2,6-difluoro-3-nitrobenzoic acid (CAS 83141-10-0) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,6-difluoro-3-nitrobenzoic acid. InChIKey: PDDHSNODMFIIRV-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,6-difluoro-3-nitrobenzoic acid |
| InChIKey | PDDHSNODMFIIRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)C(=O)O)F |
Computed by PubChem (NCBI)