Products 1121583-51-4

CAS 1121583-51-4 appears in our catalog under these names: 3,4-Difluoro-5-nitrobenzoic acid, 95%, 3,4-Difluoro-5-nitrobenzoic acid 95%, 3,4-Difluoro-5-nitrobenzoic acid, 95%, 95%, 3,4-Difluoro-5-nitrobenzoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.

Structural formula: {0} (CAS {1})

3,4-difluoro-5-nitrobenzoic acid (CAS 1121583-51-4) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 3,4-difluoro-5-nitrobenzoic acid. InChIKey: QEGLWOZIWGKZJI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3F2NO4
Molecular weight203.10 g/mol
IUPAC name3,4-difluoro-5-nitrobenzoic acid
InChIKeyQEGLWOZIWGKZJI-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1[N+](=O)[O-])F)F)C(=O)O

Computed by PubChem (NCBI)