Products 1806370-35-3
CAS 1806370-35-3 appears in our catalog under these names: 2,3-Difluoro-4-nitrobenzoic acid, 97%, 2,3-Difluoro-4-nitrobenzoic acid 98%, 2，3-Difluoro-4-Nitrobenzoic Acid, 98%, 98%, 2,3-DIFLUORO-4-NITROBENZOIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
2,3-difluoro-4-nitrobenzoic acid (CAS 1806370-35-3) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,3-difluoro-4-nitrobenzoic acid. InChIKey: MNVKJEDUWUEZEQ-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,3-difluoro-4-nitrobenzoic acid |
| InChIKey | MNVKJEDUWUEZEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)