Products 741721-49-3

CAS 741721-49-3 appears in our catalog under these names: 2,5–Difluoro–3–nitrobenzoic acid, 2,5-Difluoro-3-nitrobenzoic acid, 2,5-Difluoro-3-nitrobenzoic acid, 95%, 2,5-Difluoro-3-nitrobenzoic acid 98%, 2,5-Difluoro-3-nitrobenzoic acid, 98%, 98%. Offered by: GLPBio, Biosynth, Fluorochem, Combi-blocks, Ambeed. Available pack sizes: 100mg, 1g, 10g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2,5-difluoro-3-nitrobenzoic acid (CAS 741721-49-3) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,5-difluoro-3-nitrobenzoic acid. InChIKey: KMUYMGMBJNSLQM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3F2NO4
Molecular weight203.10 g/mol
IUPAC name2,5-difluoro-3-nitrobenzoic acid
InChIKeyKMUYMGMBJNSLQM-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)F)[N+](=O)[O-])F

Computed by PubChem (NCBI)