Products 148928-60-3
CAS 148928-60-3 is the registry number for 2,2-difluoro-4-nitro-2H-1,3-benzodioxole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2-difluoro-4-nitro-1,3-benzodioxole (CAS 148928-60-3) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,2-difluoro-4-nitro-1,3-benzodioxole. InChIKey: HEOPSYMOYVGPSB-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,2-difluoro-4-nitro-1,3-benzodioxole |
| InChIKey | HEOPSYMOYVGPSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)