cas: 29312-99-0 — see every product listed under this CAS number, including other names
2,5-Dibromonicotinic Acid, 97%, 97% (CAS 29312-99-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Y2R-250mg |
| cas | 29312-99-0 |
| size | 250mg |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 25g | 1000.40 Pln | |
| Chemat | 100g | 2963.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,5-dibromopyridine-3-carboxylic acid (CAS 29312-99-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,5-dibromopyridine-3-carboxylic acid. InChIKey: BRPWRSWAXHWEPS-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,5-dibromopyridine-3-carboxylic acid |
| InChIKey | BRPWRSWAXHWEPS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)