2,5-Dibromonicotinic acid, 95%
cas: 29312-99-0 — see every product listed under this CAS number, including other names
2,5-Dibromonicotinic acid, 95% (CAS 29312-99-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075648-1G |
| cas | 29312-99-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 466.52 Pln | |
| Fluorochem | 25g | 1075.68 Pln | |
| Fluorochem | 50g | 2101.36 Pln | |
| Fluorochem | 100g | 4137.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,5-dibromopyridine-3-carboxylic acid (CAS 29312-99-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,5-dibromopyridine-3-carboxylic acid. InChIKey: BRPWRSWAXHWEPS-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,5-dibromopyridine-3-carboxylic acid |
| InChIKey | BRPWRSWAXHWEPS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)