cas: 741721-49-3 — see every product listed under this CAS number, including other names
2,5-Difluoro-3-nitrobenzoic acid 98% (CAS 741721-49-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A601510-100mg |
| cas | 741721-49-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A601510 |
2,5-difluoro-3-nitrobenzoic acid (CAS 741721-49-3) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,5-difluoro-3-nitrobenzoic acid. InChIKey: KMUYMGMBJNSLQM-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,5-difluoro-3-nitrobenzoic acid |
| InChIKey | KMUYMGMBJNSLQM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)