cas: 261945-05-5 — see every product listed under this CAS number, including other names
2,5-Difluoro-4-(trifluoromethyl)benzoic acid, 95%, 95% (CAS 261945-05-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113S6P-100mg |
| cas | 261945-05-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 770.00 Pln | |
| Chemat | 5g | 2190.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,5-difluoro-4-(trifluoromethyl)benzoic acid (CAS 261945-05-5) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 2,5-difluoro-4-(trifluoromethyl)benzoic acid. InChIKey: DMVHPNBSOAALGT-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,5-difluoro-4-(trifluoromethyl)benzoic acid |
| InChIKey | DMVHPNBSOAALGT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)