Products 261945-05-5

CAS 261945-05-5 appears in our catalog under these names: 2,5-Difluoro-4-(trifluoromethyl)benzoic acid, 97%, 2,5-Difluoro-4-(trifluoromethyl)benzoic acid 95%, 2,5-Difluoro-4-(trifluoromethyl)benzoic acid, 95%, 95%, 2,5-Difluoro-4-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,5-difluoro-4-(trifluoromethyl)benzoic acid (CAS 261945-05-5) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 2,5-difluoro-4-(trifluoromethyl)benzoic acid. InChIKey: DMVHPNBSOAALGT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3F5O2
Molecular weight226.10 g/mol
IUPAC name2,5-difluoro-4-(trifluoromethyl)benzoic acid
InChIKeyDMVHPNBSOAALGT-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)C(F)(F)F)F)C(=O)O

Computed by PubChem (NCBI)