CAS 157337-81-0 appears in our catalog under these names: 2,4-Difluoro-3-(trifluoromethyl)benzoic acid, 98%, 2,4-Difluoro-3-(trifluoromethyl)benzoic acid, 97%, 97%, 2,4-Difluoro-3-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 25g, 100mg.
2,4-difluoro-3-(trifluoromethyl)benzoic acid (CAS 157337-81-0) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 2,4-difluoro-3-(trifluoromethyl)benzoic acid. InChIKey: RHOJXSFJDSOLSS-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,4-difluoro-3-(trifluoromethyl)benzoic acid |
| InChIKey | RHOJXSFJDSOLSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)C(F)(F)F)F |
Computed by PubChem (NCBI)