CAS 237761-76-1 appears in our catalog under these names: 3,4-Difluoro-5-(trifluoromethyl)benzoic acid, 95%, 3,4-Difluoro-5-(trifluoromethyl)benzoic acid, 95+%, 3,4-Difluoro-5-(trifluoromethyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 500mg, 1000mg, 2000mg, 5000mg.
3,4-difluoro-5-(trifluoromethyl)benzoic acid (CAS 237761-76-1) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 3,4-difluoro-5-(trifluoromethyl)benzoic acid. InChIKey: CKUNRJPLPRCMCL-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 3,4-difluoro-5-(trifluoromethyl)benzoic acid |
| InChIKey | CKUNRJPLPRCMCL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)