CAS 2149602-63-9 appears in our catalog under these names: 2,4-Difluoro-3-(trifluoromethoxy)benzaldehyde, 95%, 2,4-Difluoro-3-(trifluoromethoxy)benzaldehyde, 98%, 2,4-Difluoro-3-(trifluoromethoxy)benzaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 5g, 2,5g.
2,4-difluoro-3-(trifluoromethoxy)benzaldehyde (CAS 2149602-63-9) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 2,4-difluoro-3-(trifluoromethoxy)benzaldehyde. InChIKey: XPVMCNNIRWNZCS-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,4-difluoro-3-(trifluoromethoxy)benzaldehyde |
| InChIKey | XPVMCNNIRWNZCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)F)OC(F)(F)F)F |
Computed by PubChem (NCBI)