CAS 261945-09-9 appears in our catalog under these names: 3,5-Difluoro-4-(trifluoromethyl)benzoic acid 98%, 3,5-Difluoro-4-(trifluoromethyl)benzoic acid, 98%, 98%, 3,5-Difluoro-4-(trifluoromethyl)benzoic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,5-difluoro-4-(trifluoromethyl)benzoic acid (CAS 261945-09-9) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 3,5-difluoro-4-(trifluoromethyl)benzoic acid. InChIKey: MKESWMDKZFRERU-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 3,5-difluoro-4-(trifluoromethyl)benzoic acid |
| InChIKey | MKESWMDKZFRERU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)