Products 916155-26-5
CAS 916155-26-5 appears in our catalog under these names: 3,5-Difluoro-4-(trifluoromethoxy)benzaldehyde, 98%, 3，5–Difluoro–4–(trifluoromethoxy)benzaldehyde. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g, 100mg, 250mg, 25mg.
3,5-difluoro-4-(trifluoromethoxy)benzaldehyde (CAS 916155-26-5) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 3,5-difluoro-4-(trifluoromethoxy)benzaldehyde. InChIKey: DWLQYXFFOVOCSX-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 3,5-difluoro-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | DWLQYXFFOVOCSX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OC(F)(F)F)F)C=O |
Computed by PubChem (NCBI)