Products 261945-01-1
CAS 261945-01-1 appears in our catalog under these names: 2,4-difluoro-5-(trifluoromethyl)benzoic acid, 95%, 2,4-Difluoro-5-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2,4-difluoro-5-(trifluoromethyl)benzoic acid (CAS 261945-01-1) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 2,4-difluoro-5-(trifluoromethyl)benzoic acid. InChIKey: SQWIBAQCNRNRKF-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,4-difluoro-5-(trifluoromethyl)benzoic acid |
| InChIKey | SQWIBAQCNRNRKF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(F)(F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)