CAS 1262414-83-4 is the registry number for 2,2-Difluoro-5-(trifluoromethyl)benzo[d][1,3]dioxole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-5-(trifluoromethyl)-1,3-benzodioxole (CAS 1262414-83-4) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 2,2-difluoro-5-(trifluoromethyl)-1,3-benzodioxole. InChIKey: GJOCOCXBCQWAFC-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,2-difluoro-5-(trifluoromethyl)-1,3-benzodioxole |
| InChIKey | GJOCOCXBCQWAFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)OC(O2)(F)F |
Computed by PubChem (NCBI)