Products 1048921-49-8
CAS 1048921-49-8 appears in our catalog under these names: 2,6-Difluoro-3-(trifluoromethyl)benzoic acid, 2,6-Difluoro-3-(trifluoromethyl)benzoic acid 98%, 2,6-Difluoro-3-(trifluoromethyl)benzoic acid, 98%, 98%, 2,6-Difluoro-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g.
2,6-difluoro-3-(trifluoromethyl)benzoic acid (CAS 1048921-49-8) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 2,6-difluoro-3-(trifluoromethyl)benzoic acid. InChIKey: CVJDKSBPBBKDEN-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,6-difluoro-3-(trifluoromethyl)benzoic acid |
| InChIKey | CVJDKSBPBBKDEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)C(=O)O)F |
Computed by PubChem (NCBI)