cas: 1260898-43-8 — see every product listed under this CAS number, including other names
2,6-Dichloro-1,8-naphthyridine, 98%, 98% (CAS 1260898-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RK8-100mg |
| cas | 1260898-43-8 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 136.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-1,8-naphthyridine (CAS 1260898-43-8) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,6-dichloro-1,8-naphthyridine. InChIKey: KHTSXPVKNKHVDM-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,6-dichloro-1,8-naphthyridine |
| InChIKey | KHTSXPVKNKHVDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)