cas: 618-80-4 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-nitrophenol, 98%, 98% (CAS 618-80-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G41-5g |
| cas | 618-80-4 |
| size | 5g |
| availability | 2800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 304.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-nitrophenol (CAS 618-80-4) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,6-dichloro-4-nitrophenol. InChIKey: PXSGFTWBZNPNIC-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,6-dichloro-4-nitrophenol |
| InChIKey | PXSGFTWBZNPNIC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)