2,6-Difluoro-4-methoxyphenylboronic acid, 97%
cas: 406482-20-0 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-methoxyphenylboronic acid, 97% (CAS 406482-20-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A169670-250mg |
| cas | 406482-20-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 698.56 Pln | |
| Ambeed | 100g | 2578.69 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 269.93 Pln | |
| BLDpharm | 25g | 747.54 Pln | |
| BLDpharm | 100g | 2774.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2,6-difluoro-4-methoxyphenyl)boronic acid (CAS 406482-20-0) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,6-difluoro-4-methoxyphenyl)boronic acid. InChIKey: WVSZSFADEBGONQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,6-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | WVSZSFADEBGONQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-Difluoro-4-methoxyphenylboronic acid, (2,6-difluoro-4-methoxyphenyl)boronic acid, (2,6-Difluoro-4-methoxy-phenyl)boronic acid, Boronic acid, (2,6-difluoro-4-methoxyphenyl)-, 2,6-difluoro-4-methoxy-phenyl-boronic acid, 2,6-Difluoro-4-methoxyphenylboronic acid, >=95%, 2 6-Difluoro-4-Methoxyphenylboronic Acid, 2,6-Difluoro-4-methoxyphenylboronicacid, 2,6-difluoro-4-methoxyphenyl boronic acid, 2,6-Difluoro-4-methoxyphenylboronic acid(contains varying amounts of Anhydride)