Products 406482-20-0
CAS 406482-20-0 appears in our catalog under these names: 2,6–Difluoro–4–methoxyphenylboronic acid(contains varying amounts of Anhydride), 2,6-Difluoro-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride), 2,6-Difluoro-4-methoxyphenylboronic acid, 97%, 97%, 2,6-Difluoro-4-methoxyphenylboronic acid, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
(2,6-difluoro-4-methoxyphenyl)boronic acid (CAS 406482-20-0) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,6-difluoro-4-methoxyphenyl)boronic acid. InChIKey: WVSZSFADEBGONQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,6-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | WVSZSFADEBGONQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-Difluoro-4-methoxyphenylboronic acid, (2,6-difluoro-4-methoxyphenyl)boronic acid, (2,6-Difluoro-4-methoxy-phenyl)boronic acid, Boronic acid, (2,6-difluoro-4-methoxyphenyl)-, 2,6-difluoro-4-methoxy-phenyl-boronic acid, 2,6-Difluoro-4-methoxyphenylboronic acid, >=95%, 2 6-Difluoro-4-Methoxyphenylboronic Acid, 2,6-Difluoro-4-methoxyphenylboronicacid, 2,6-difluoro-4-methoxyphenyl boronic acid, 2,6-Difluoro-4-methoxyphenylboronic acid(contains varying amounts of Anhydride)