2,6-Difluoro-4-methoxyphenylboronic acid, 95%
cas: 406482-20-0 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-methoxyphenylboronic acid, 95% (CAS 406482-20-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8Z5-250mg |
| cas | 406482-20-0 |
| size | 250mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 256.40 Pln | |
| Chemat | 25g | 544.40 Pln | |
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 5g | 211.40 Pln | |
| Fluorochem | 10g | 336.36 Pln | |
| Fluorochem | 25g | 586.27 Pln | |
| Fluorochem | 100g | 2137.81 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,6-difluoro-4-methoxyphenyl)boronic acid (CAS 406482-20-0) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,6-difluoro-4-methoxyphenyl)boronic acid. InChIKey: WVSZSFADEBGONQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,6-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | WVSZSFADEBGONQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-Difluoro-4-methoxyphenylboronic acid, (2,6-difluoro-4-methoxyphenyl)boronic acid, (2,6-Difluoro-4-methoxy-phenyl)boronic acid, Boronic acid, (2,6-difluoro-4-methoxyphenyl)-, 2,6-difluoro-4-methoxy-phenyl-boronic acid, 2,6-Difluoro-4-methoxyphenylboronic acid, >=95%, 2 6-Difluoro-4-Methoxyphenylboronic Acid, 2,6-Difluoro-4-methoxyphenylboronicacid, 2,6-difluoro-4-methoxyphenyl boronic acid, 2,6-Difluoro-4-methoxyphenylboronic acid(contains varying amounts of Anhydride)