cas: 101488-73-7 — see every product listed under this CAS number, including other names
2,6-Dihydroxyanthracene, 97%, 97% (CAS 101488-73-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115LM-250mg |
| cas | 101488-73-7 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 261.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Anthracene-2,6-diol (CAS 101488-73-7) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: anthracene-2,6-diol. InChIKey: JBBHFHMVEOHFRE-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | anthracene-2,6-diol |
| InChIKey | JBBHFHMVEOHFRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)O)O |
Computed by PubChem (NCBI)