cas: 1256355-34-6 — see every product listed under this CAS number, including other names
2,6-Dimethoxy-4-formylphenylboronic acid, 98%, 98% (CAS 1256355-34-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O4A-100mg |
| cas | 1256355-34-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 2013.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-formyl-2,6-dimethoxyphenyl)boronic acid (CAS 1256355-34-6) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-2,6-dimethoxyphenyl)boronic acid. InChIKey: SNAHFCPYLSJIAT-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-2,6-dimethoxyphenyl)boronic acid |
| InChIKey | SNAHFCPYLSJIAT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)