cas: 120258-69-7 — see every product listed under this CAS number, including other names
2,8-Dichloroquinoxaline, 95%, 95% (CAS 120258-69-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187U8-100mg |
| cas | 120258-69-7 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1451.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,8-dichloroquinoxaline (CAS 120258-69-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,8-dichloroquinoxaline. InChIKey: OSJZMZFNSNCFCO-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,8-dichloroquinoxaline |
| InChIKey | OSJZMZFNSNCFCO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)