cas: 351003-45-7 — see every product listed under this CAS number, including other names
2–Bromo–4–fluorobenzenesulfonyl chloride (CAS 351003-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD23510-100g |
| cas | 351003-45-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 1359.96 Pln | |
| GLPBio | 25g | 812.34 Pln | |
| GLPBio | 5g | 512.79 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-4-fluorobenzenesulfonyl chloride (CAS 351003-45-7) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 2-bromo-4-fluorobenzenesulfonyl chloride. InChIKey: GJPWPFVLPNTOOL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 2-bromo-4-fluorobenzenesulfonyl chloride |
| InChIKey | GJPWPFVLPNTOOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)