Products 1214342-44-5
CAS 1214342-44-5 appears in our catalog under these names: 3-Bromo-5-fluorobenzenesulfonyl chloride, 95%, 3-Bromo-5-fluorobenzene-1-sulfonyl chloride, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-bromo-5-fluorobenzenesulfonyl chloride (CAS 1214342-44-5) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 3-bromo-5-fluorobenzenesulfonyl chloride. InChIKey: HZJBQCUMWMMHMK-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 3-bromo-5-fluorobenzenesulfonyl chloride |
| InChIKey | HZJBQCUMWMMHMK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)Cl)Br)F |
Computed by PubChem (NCBI)