cas: 67092-18-6 — see every product listed under this CAS number, including other names
2,6-dichloroquinazoline, 97%, 97% (CAS 67092-18-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FFCK-100mg |
| cas | 67092-18-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 500mg | 1178.00 Pln | |
| Chemat | 1g | 1638.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloroquinazoline (CAS 67092-18-6) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,6-dichloroquinazoline. InChIKey: XRATUNPMHQSOFL-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,6-dichloroquinazoline |
| InChIKey | XRATUNPMHQSOFL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NC=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)