cas: 78754-94-6 — see every product listed under this CAS number, including other names
2-(2,4-Dioxo-1,2-dihydroquinazolin-3(4H)-yl)acetic acid, 98% (CAS 78754-94-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A140830-10g |
| cas | 78754-94-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4093.18 Pln | |
| AmBeed | 25g | 8363.74 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid (CAS 78754-94-6) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid. InChIKey: RQQGYSJFFRKGNY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid |
| InChIKey | RQQGYSJFFRKGNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)